[2-(4-Methoxyphenoxy)ethyl]ammonium chloride

• Catalog Number: ACMA00002827
• Category: Ethers
• Molecular Weight: 203.67
• Molecular Formula: C₉H₁₃NO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The molecular formula is C9H14ClNO2.

What is the molecular weight of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The molecular weight is 203.66 g/mol.

What is the IUPAC name of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The IUPAC name is 2-(4-methoxyphenoxy)ethylazanium chloride.

What is the InChI of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The InChI is InChI=1S/C9H13NO2.ClH/c1-11-8-2-4-9(5-3-8)12-7-6-10;/h2-5H,6-7,10H2,1H3;1H.

What is the InChIKey of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The InChIKey is YCFXTJDWVNEVEX-UHFFFAOYSA-N.

What is the canonical SMILES of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The canonical SMILES is COC1=CC=C(C=C1)OCC[NH3+].[Cl-].

What is the hydrogen bond donor count of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The hydrogen bond acceptor count is 3.

How many rotatable bonds are there in [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

There are 4 rotatable bonds.

What is the heavy atom count of [2-(4-Methoxyphenoxy)ethyl]ammonium chloride?

The heavy atom count is 13.