4-(4-Methoxyphenyl)phenylboronic acid

• CAS: 156642-03-4
• Catalog Number: ACM156642034
• Category: Boronic Acids
• Molecular Weight: 228.05
• Molecular Formula: C₁₃H₁₃BO₃

Custom Q&A

What is the molecular formula of 4-(4-Methoxyphenyl)phenylboronic acid?

The molecular formula is C13H13BO3.

What are the synonyms of 4-(4-Methoxyphenyl)phenylboronic acid?

The synonyms include 156642-03-4, (4'-Methoxy-[1,1'-biphenyl]-4-yl)boronic acid, [4-(4-methoxyphenyl)phenyl]boronic Acid, 4'-METHOXYBIPHENYL-4-YLBORONIC ACID, and 4-(4-methoxyphenyl)phenylboronic acid.

When was 4-(4-Methoxyphenyl)phenylboronic acid created and modified?

It was created on September 13, 2005, and modified on December 2, 2023.

What is the IUPAC name of 4-(4-Methoxyphenyl)phenylboronic acid?

The IUPAC name is [4-(4-methoxyphenyl)phenyl]boronic acid.

What is the InChI of 4-(4-Methoxyphenyl)phenylboronic acid?

The InChI is InChI=1S/C13H13BO3/c1-17-13-8-4-11(5-9-13)10-2-6-12(7-3-10)14(15)16/h2-9,15-16H,1H3.

What is the InChIKey of 4-(4-Methoxyphenyl)phenylboronic acid?

The InChIKey is VIHQQLWZRRVBNE-UHFFFAOYSA-N.

What is the canonical SMILES of 4-(4-Methoxyphenyl)phenylboronic acid?

The canonical SMILES is B(C1=CC=C(C=C1)C2=CC=C(C=C2)OC)(O)O.

What is the molecular weight of 4-(4-Methoxyphenyl)phenylboronic acid?

The molecular weight is 228.05 g/mol.

What is the hydrogen bond donor count of 4-(4-Methoxyphenyl)phenylboronic acid?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of 4-(4-Methoxyphenyl)phenylboronic acid?

The hydrogen bond acceptor count is 3.