CAS
153254-09-2 Purity
---
153254-09-2 Purity
---
Inquiry Basket
3-Isoproproxy-4-methylphenylboronic acid
CAS
1451390-96-7
Catalog Number
ACM1451390967
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Isoproproxy-4-methylphenylboronic acid?
The molecular formula of 3-Isoproproxy-4-methylphenylboronic acid is C10H15BO3.
When was 3-Isoproproxy-4-methylphenylboronic acid created?
3-Isoproproxy-4-methylphenylboronic acid was created on January 24, 2012.
What is the IUPAC name of 3-Isoproproxy-4-methylphenylboronic acid?
The IUPAC name of 3-Isoproproxy-4-methylphenylboronic acid is (4-methyl-3-propan-2-yloxyphenyl)boronic acid.
What is the InChI of 3-Isoproproxy-4-methylphenylboronic acid?
The InChI of 3-Isoproproxy-4-methylphenylboronic acid is InChI=1S/C10H15BO3/c1-7(2)14-10-6-9(11(12)13)5-4-8(10)3/h4-7,12-13H,1-3H3.
What is the InChIKey of 3-Isoproproxy-4-methylphenylboronic acid?
The InChIKey of 3-Isoproproxy-4-methylphenylboronic acid is QVLSKSUTMJVODT-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Isoproproxy-4-methylphenylboronic acid?
The canonical SMILES of 3-Isoproproxy-4-methylphenylboronic acid is B(C1=CC(=C(C=C1)C)OC(C)C)(O)O.
What is the molecular weight of 3-Isoproproxy-4-methylphenylboronic acid?
The molecular weight of 3-Isoproproxy-4-methylphenylboronic acid is 194.04 g/mol.
How many hydrogen bond donor counts does 3-Isoproproxy-4-methylphenylboronic acid have?
3-Isoproproxy-4-methylphenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 3-Isoproproxy-4-methylphenylboronic acid have?
3-Isoproproxy-4-methylphenylboronic acid has 3 hydrogen bond acceptor counts.
How many rotatable bond counts does 3-Isoproproxy-4-methylphenylboronic acid have?
3-Isoproproxy-4-methylphenylboronic acid has 3 rotatable bond counts.
Recommended Products
