4-[(4-Chlorobenzyl)oxy]benzoic acid

• Catalog Number: ACMA00002463
• Category: Ethers
• Molecular Weight: 262.69
• Molecular Formula: C₁₄H₁₁BrO₂
• Hazard Statements: H301
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C14H11ClO3.

What is the molecular weight of the compound?

The molecular weight is 262.69 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 4-[(4-chlorophenyl)methoxy]benzoic acid.

What is the InChI of the compound?

The InChI is: InChI=1S/C14H11ClO3/c15-12-5-1-10(2-6-12)9-18-13-7-3-11(4-8-13)14(16)17/h1-8H,9H2,(H,16,17).

What is the InChIKey of the compound?

The InChIKey is WRELJNMKLNHYCU-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is C1=CC(=CC=C1COC2=CC=C(C=C2)C(=O)O)Cl.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 3.5.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 4 rotatable bond counts.