3-((4-Nitrobenzyl)oxy)benzaldehyde

• Catalog Number: ACMA00002460
• Category: Ethers
• Molecular Weight: 257.24
• Molecular Formula: C₁₄H₁₁BrO₂
• Hazard Statements: H302-H317
• RIDADR: UN3077 - class 9 - PG 3 - DOT/IATA UN3335 - Environmentally hazardous substances, solid, n.o.s., HI: all (not BR)
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3-((4-Nitrobenzyl)oxy)benzaldehyde?

The molecular formula is C14H11NO4.

What is the molecular weight of 3-((4-Nitrobenzyl)oxy)benzaldehyde?

The molecular weight is 257.24 g/mol.

What is the IUPAC name of 3-((4-Nitrobenzyl)oxy)benzaldehyde?

The IUPAC name is 3-[(4-nitrophenyl)methoxy]benzaldehyde.

What is the InChIKey of 3-((4-Nitrobenzyl)oxy)benzaldehyde?

The InChIKey is GMZGJTDCLVLLQA-UHFFFAOYSA-N.

What is the Canonical SMILES of 3-((4-Nitrobenzyl)oxy)benzaldehyde?

The Canonical SMILES is C1=CC(=CC(=C1)OCC2=CC=C(C=C2)[N+](=O)[O-])C=O.

What is the CAS number of 3-((4-Nitrobenzyl)oxy)benzaldehyde?

The CAS number is 247089-42-5.

How many hydrogen bond donor count does 3-((4-Nitrobenzyl)oxy)benzaldehyde have?

It has 0 hydrogen bond donor count.

What is the topological polar surface area of 3-((4-Nitrobenzyl)oxy)benzaldehyde?

The topological polar surface area is 72.1Ų.

How many rotatable bond counts does 3-((4-Nitrobenzyl)oxy)benzaldehyde have?

It has 4 rotatable bond counts.

Is 3-((4-Nitrobenzyl)oxy)benzaldehyde a canonicalized compound?

Yes, it is a canonicalized compound.