4-[(2,6-Dichlorobenzyl)oxy]-3-ethoxybenzaldehyde

• Catalog Number: ACMA00002989
• Category: Ethers
• Molecular Weight: 325.19
• Molecular Formula: C₁₆H₁₃FO₄
• Hazard Statements: H302
• RIDADR: UN 2811 6.1 / PGIII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C16H14Cl2O3.

What is the molecular weight of the compound?

The molecular weight is 325.2 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 4-[(2,6-dichlorophenyl)methoxy]-3-ethoxybenzaldehyde.

What is the InChI of the compound?

The InChI is InChI=1S/C16H14Cl2O3/c1-2-20-16-8-11(9-19)6-7-15(16)21-10-12-13(17)4-3-5-14(12)18/h3-9H,2,10H2,1H3.

What is the InChIKey of the compound?

The InChIKey is YYKGJSYGQDBZLW-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CCOC1=C(C=CC(=C1)C=O)OCC2=C(C=CC=C2Cl)Cl.

What is the CAS number of the compound?

The CAS number is 568556-77-4.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 4.4.

How many hydrogen bond donor counts does the compound have?

The compound has 0 hydrogen bond donor counts.

How many rotatable bond counts does the compound have?

The compound has 6 rotatable bond counts.