What is the molecular formula of 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione?
The molecular formula is C16H13NO3.
What is the molecular weight of 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione?
The molecular weight is 267.28 g/mol.
What is the IUPAC name of 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione?
The IUPAC name is 2-(2-methoxyphenyl)-4H-isoquinoline-1,3-dione.
What is the InChI of 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione?
The InChI is InChI=1S/C16H13NO3/c1-20-14-9-5-4-8-13(14)17-15(18)10-11-6-2-3-7-12(11)16(17)19/h2-9H,10H2,1H3.
What is the InChIKey of 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione?
The InChIKey is XGAWVNADRTWTGY-UHFFFAOYSA-N.
What is the canonical SMILES of 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione?
The canonical SMILES is COC1=CC=CC=C1N2C(=O)CC3=CC=CC=C3C2=O.
What is the CAS number of 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione?
The CAS number is 106128-44-3.
What is the ChEMBL ID of 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione?
The ChEMBL ID is CHEMBL88811.
Is 2-(2-Methoxyphenyl)isoquinoline-1,3(2H,4H)-dione a covalently-bonded unit?
Yes, it is a covalently-bonded unit with a count of 1.