3-(trifluoromethyl)pyrazin-2-amine

• CAS: 213019-67-1
• Catalog Number: ACM213019671
• Category: Pyrazines
• Molecular Weight: 163.0
• Molecular Formula: C5H4F3N3
• Appearance: White Powder

Custom Q&A

What is the molecular formula of 3-(trifluoromethyl)pyrazin-2-amine?

The molecular formula is C5H4F3N3.

What is the molecular weight of 3-(trifluoromethyl)pyrazin-2-amine?

The molecular weight is 163.10 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-(trifluoromethyl)pyrazin-2-amine.

What is the InChI of 3-(trifluoromethyl)pyrazin-2-amine?

The InChI is InChI=1S/C5H4F3N3/c6-5(7,8)3-4(9)11-2-1-10-3/h1-2H,(H2,9,11).

What is the InChIKey of the compound?

The InChIKey is GDOQHWXDKQJKLT-UHFFFAOYSA-N.

What is the canonical SMILES of 3-(trifluoromethyl)pyrazin-2-amine?

The canonical SMILES is C1=CN=C(C(=N1)C(F)(F)F)N.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 6 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area is 51.8 Å2.

Is the compound canonicalized?

Yes, the compound is canonicalized.