3-Sulfopropyl acrylate,potassium salt(spak)

CAS

31098-20-1

Catalog Number

ACM31098201

Category

Polymer/Macromolecule

Molecular Weight

232.3

Molecular Formula

C₆H₉KO₅S

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

Specification

Synonyms

3-sulfopropylacrylate,potassiumsalt(98%);POTASSIUM SULFOPROPYLACRYLATE;SPA;3-SULFOPROPYL ACRYLATE, POTASSIUM SALT;2-Propenoic acid 3-sulfopropylester, potassium salt;3-Sulfopropyl acrylate;Acrylic acid-(3-sulfopropyl)ester, potassium salt;potassium 3-sulp

Appearance

White powder

What is the molecular formula of 3-Sulfopropyl acrylate, potassium salt (Spak)?

The molecular formula of 3-Sulfopropyl acrylate, potassium salt (Spak) is C6H9KO5S.

What is the molecular weight of 3-Sulfopropyl acrylate, potassium salt (Spak)?

The molecular weight of 3-Sulfopropyl acrylate, potassium salt (Spak) is 232.30 g/mol.

What is the IUPAC name of 3-Sulfopropyl acrylate, potassium salt (Spak)?

The IUPAC name of 3-Sulfopropyl acrylate, potassium salt (Spak) is potassium;3-prop-2-enoyloxypropane-1-sulfonate.

What is the InChI of 3-Sulfopropyl acrylate, potassium salt (Spak)?

The InChI of 3-Sulfopropyl acrylate, potassium salt (Spak) is InChI=1S/C6H10O5S.K/c1-2-6(7)11-4-3-5-12(8,9)10;/h2H,1,3-5H2,(H,8,9,10);/q;+1/p-1.

What is the canonical SMILES of 3-Sulfopropyl acrylate, potassium salt (Spak)?

The canonical SMILES of 3-Sulfopropyl acrylate, potassium salt (Spak) is C=CC(=O)OCCCS(=O)(=O)[O-].[K+].

What is the CAS number of 3-Sulfopropyl acrylate, potassium salt (Spak)?

The CAS number of 3-Sulfopropyl acrylate, potassium salt (Spak) is 31098-20-1.

What is the molecular weight of 3-Sulfopropyl acrylate?

The molecular weight of 3-Sulfopropyl acrylate, the parent compound of Spak, is not mentioned in the reference.

How many hydrogen bond donor counts does 3-Sulfopropyl acrylate, potassium salt (Spak) have?

3-Sulfopropyl acrylate, potassium salt (Spak) has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 3-Sulfopropyl acrylate, potassium salt (Spak) have?

3-Sulfopropyl acrylate, potassium salt (Spak) has 5 hydrogen bond acceptor counts.

What is the topological polar surface area of 3-Sulfopropyl acrylate, potassium salt (Spak)?

The topological polar surface area of 3-Sulfopropyl acrylate, potassium salt (Spak) is 91.9Å².