What is the molecular formula of 3-Sulfopropyl methacrylate, potassium salt?
The molecular formula is C7H11KO5S.
When was 3-Sulfopropyl methacrylate, potassium salt created?
It was created on February 5, 2008.
What are the synonyms for 3-Sulfopropyl methacrylate, potassium salt?
Some synonyms include potassium 3-(methacryloyloxy)propane-1-sulfonate and potassium 3-sulphopropyl methacrylate.
What is the molecular weight of 3-Sulfopropyl methacrylate, potassium salt?
The molecular weight is 246.32 g/mol.
What is the IUPAC name of 3-Sulfopropyl methacrylate, potassium salt?
The IUPAC name is potassium;3-(2-methylprop-2-enoyloxy)propane-1-sulfonate.
What is the canonical SMILES for 3-Sulfopropyl methacrylate, potassium salt?
The canonical SMILES is CC(=C)C(=O)OCCCS(=O)(=O)[O-].[K+].
What is the InChIKey for 3-Sulfopropyl methacrylate, potassium salt?
The InChIKey is PNOXUQIZPBURMT-UHFFFAOYSA-M.
How many hydrogen bond acceptors does 3-Sulfopropyl methacrylate, potassium salt have?
It has 5 hydrogen bond acceptors.
What is the topological polar surface area of 3-Sulfopropyl methacrylate, potassium salt?
The topological polar surface area is 91.9Ų.
How many heavy atoms does 3-Sulfopropyl methacrylate, potassium salt contain?
It contains 14 heavy atoms.