(3-Oxo-2,3-dihydro-1H-isoindol-1-yl)acetic acid

• Catalog Number: ACMA00000792
• Category: Amines
• Molecular Weight: 191.18
• Molecular Formula: C₁₀H₉ClN₄O₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (3-Oxo-2,3-dihydro-1H-isoindol-1-yl)acetic acid?

The molecular formula is C10H9NO3.

What are some synonyms of (3-Oxo-2,3-dihydro-1H-isoindol-1-yl)acetic acid?

Some synonyms include 3849-22-7, [1(3h)-isoindolinone-3-yl]acetic acid, and 2-(3-Oxoisoindolin-1-yl)acetic acid.

What is the molecular weight of (3-Oxo-2,3-dihydro-1H-isoindol-1-yl)acetic acid?

The molecular weight is 191.18 g/mol.

What is the canonical SMILES representation of the compound?

The canonical SMILES representation is C1=CC=C2C(=C1)C(NC2=O)CC(=O)O.

What is the InChIKey of (3-Oxo-2,3-dihydro-1H-isoindol-1-yl)acetic acid?

The InChIKey is ARVSJYVMPQBCTL-UHFFFAOYSA-N.

What is the CAS number of the compound?

The CAS number is 3849-22-7.

How many hydrogen bond donor counts are there in the compound?

There are 2 hydrogen bond donor counts.

What is the topological polar surface area of (3-Oxo-2,3-dihydro-1H-isoindol-1-yl)acetic acid?

The topological polar surface area is 66.4Ų.

Is the compound canonicalized?

Yes, the compound is canonicalized.

How many rotatable bond counts are there in (3-Oxo-2,3-dihydro-1H-isoindol-1-yl)acetic acid?

There are 2 rotatable bond counts.