[(3-Methylbutanoyl)amino]acetic acid

• Catalog Number: ACMA00001455
• Category: Amines
• Molecular Weight: 159.18
• Molecular Formula: C₇H₁₂N₂S
• Hazard Statements: H226-H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS02

Custom Q&A

What is the molecular formula of [N-(3-Methylbutanoyl)amino]acetic acid?

The molecular formula of [N-(3-Methylbutanoyl)amino]acetic acid is C7H13NO3.

What is the molecular weight of [N-(3-Methylbutanoyl)amino]acetic acid?

The molecular weight of [N-(3-Methylbutanoyl)amino]acetic acid is 159.18 g/mol.

What is the IUPAC name of [N-(3-Methylbutanoyl)amino]acetic acid?

The IUPAC name of [N-(3-Methylbutanoyl)amino]acetic acid is 2-(3-methylbutanoylamino)acetic acid.

What is the InChI of [N-(3-Methylbutanoyl)amino]acetic acid?

The InChI of [N-(3-Methylbutanoyl)amino]acetic acid is InChI=1S/C7H13NO3/c1-5(2)3-6(9)8-4-7(10)11/h5H,3-4H2,1-2H3,(H,8,9)(H,10,11).

What is the InChIKey of [N-(3-Methylbutanoyl)amino]acetic acid?

The InChIKey of [N-(3-Methylbutanoyl)amino]acetic acid is ZRQXMKMBBMNNQC-UHFFFAOYSA-N.

What is the CAS number of [N-(3-Methylbutanoyl)amino]acetic acid?

The CAS number of [N-(3-Methylbutanoyl)amino]acetic acid is 16284-60-9.

What is the XLogP3 value of [N-(3-Methylbutanoyl)amino]acetic acid?

The XLogP3 value of [N-(3-Methylbutanoyl)amino]acetic acid is 1.5.

How many hydrogen bond donor counts are there in [N-(3-Methylbutanoyl)amino]acetic acid?

There are 2 hydrogen bond donor counts in [N-(3-Methylbutanoyl)amino]acetic acid.

How many hydrogen bond acceptor counts are there in [N-(3-Methylbutanoyl)amino]acetic acid?

There are 3 hydrogen bond acceptor counts in [N-(3-Methylbutanoyl)amino]acetic acid.

How many rotatable bond counts are there in [N-(3-Methylbutanoyl)amino]acetic acid?

There are 4 rotatable bond counts in [N-(3-Methylbutanoyl)amino]acetic acid.