CAS
--- Purity
---
--- Purity
---
Inquiry Basket
3-(Methoxymethyl)benzoic acid
Catalog Number
ACMA00002896
Category
Ethers
Molecular Weight
166.17
Molecular Formula
C9H10N2O2
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H319
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 3-(Methoxymethyl)benzoic acid?
The molecular formula of 3-(Methoxymethyl)benzoic acid is C9H10O3.
What is the molecular weight of 3-(Methoxymethyl)benzoic acid?
The molecular weight of 3-(Methoxymethyl)benzoic acid is 166.17 g/mol.
What is the IUPAC name of 3-(Methoxymethyl)benzoic acid?
The IUPAC name of 3-(Methoxymethyl)benzoic acid is 3-(methoxymethyl)benzoic acid.
What is the InChI of 3-(Methoxymethyl)benzoic acid?
The InChI of 3-(Methoxymethyl)benzoic acid is InChI=1S/C9H10O3/c1-12-6-7-3-2-4-8(5-7)9(10)11/h2-5H,6H2,1H3,(H,10,11).
What is the InChIKey of 3-(Methoxymethyl)benzoic acid?
The InChIKey of 3-(Methoxymethyl)benzoic acid is ZPBMOTGPFVLBMN-UHFFFAOYSA-N.
What is the canonical SMILES of 3-(Methoxymethyl)benzoic acid?
The canonical SMILES of 3-(Methoxymethyl)benzoic acid is COCC1=CC(=CC=C1)C(=O)O.
What is the CAS number of 3-(Methoxymethyl)benzoic acid?
The CAS number of 3-(Methoxymethyl)benzoic acid is 32194-76-6.
What is the molecular weight of 3-(Methoxymethyl)benzoic acid according to PubChem?
The molecular weight of 3-(Methoxymethyl)benzoic acid according to PubChem is 166.17 g/mol.
How many hydrogen bond donor counts are there in 3-(Methoxymethyl)benzoic acid?
There is 1 hydrogen bond donor count in 3-(Methoxymethyl)benzoic acid.
How many hydrogen bond acceptor counts are there in 3-(Methoxymethyl)benzoic acid?
There are 3 hydrogen bond acceptor counts in 3-(Methoxymethyl)benzoic acid.
Recommended Products
