3-(2-Hydroxyethoxy)benzaldehyde

• Catalog Number: ACMA00002894
• Category: Ethers
• Molecular Weight: 166.17
• Molecular Formula: C₉H₁₀N₂O₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula is C9H10O3.

What is the molecular weight of the compound?

The molecular weight is 166.17 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-(2-hydroxyethoxy)benzaldehyde.

What is the InChI of the compound?

The InChI is InChI=1S/C9H10O3/c10-4-5-12-9-3-1-2-8(6-9)7-11/h1-3,6-7,10H,4-5H2.

What is the InChIKey of the compound?

The InChIKey is LIUCHRXQRHVSJI-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is C1=CC(=CC(=C1)OCCO)C=O.

What is the XLogP3-AA value of the compound?

The XLogP3-AA value is 0.7.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does the compound have?

The compound has 4 rotatable bond counts.