CAS
--- Purity
---
--- Purity
---
Inquiry Basket
3-Isopropoxy-4-methoxybenzoic acid
Catalog Number
ACMA00002137
Category
Ethers
Molecular Weight
210.23
Molecular Formula
C11H14O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302
RIDADR
UN 2811 6.1 / PGIII
Symbol
GHS07
What is the molecular formula of 3-Isopropoxy-4-methoxybenzoic acid?
The molecular formula of 3-Isopropoxy-4-methoxybenzoic acid is C11H14O4.
What is the molecular weight of 3-Isopropoxy-4-methoxybenzoic acid?
The molecular weight of 3-Isopropoxy-4-methoxybenzoic acid is 210.23 g/mol.
What is the IUPAC name of 3-Isopropoxy-4-methoxybenzoic acid?
The IUPAC name of 3-Isopropoxy-4-methoxybenzoic acid is 4-methoxy-3-propan-2-yloxybenzoic acid.
What is the InChI of 3-Isopropoxy-4-methoxybenzoic acid?
The InChI of 3-Isopropoxy-4-methoxybenzoic acid is InChI=1S/C11H14O4/c1-7(2)15-10-6-8(11(12)13)4-5-9(10)14-3/h4-7H,1-3H3,(H,12,13).
What is the InChIKey of 3-Isopropoxy-4-methoxybenzoic acid?
The InChIKey of 3-Isopropoxy-4-methoxybenzoic acid is RWEWUTIPMKOWRT-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Isopropoxy-4-methoxybenzoic acid?
The canonical SMILES of 3-Isopropoxy-4-methoxybenzoic acid is CC(C)OC1=C(C=CC(=C1)C(=O)O)OC.
What is the CAS number of 3-Isopropoxy-4-methoxybenzoic acid?
The CAS number of 3-Isopropoxy-4-methoxybenzoic acid is 159783-29-6.
What is the molecular weight of 3-Isopropoxy-4-methoxybenzoic acid according to PubChem?
The molecular weight of 3-Isopropoxy-4-methoxybenzoic acid according to PubChem is 210.23 g/mol.
What is the XLogP3 value of 3-Isopropoxy-4-methoxybenzoic acid?
The XLogP3 value of 3-Isopropoxy-4-methoxybenzoic acid is 2.4.
How many hydrogen bond acceptor count does 3-Isopropoxy-4-methoxybenzoic acid have?
3-Isopropoxy-4-methoxybenzoic acid has 4 hydrogen bond acceptor count.
Recommended Products
