4-Methoxy-3-propoxybenzoic acid

• Catalog Number: ACMA00002134
• Category: Ethers
• Molecular Weight: 210.23
• Molecular Formula: C₁₁H₁₄O₃
• Hazard Statements: H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C11H14O4.

What is the molecular weight of the compound?

The molecular weight of the compound is 210.23 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 4-methoxy-3-propoxybenzoic acid.

What is the InChI of the compound?

The InChI of the compound is InChI=1S/C11H14O4/c1-3-6-15-10-7-8(11(12)13)4-5-9(10)14-2/h4-5,7H,3,6H2,1-2H3,(H,12,13).

What is the InChIKey of the compound?

The InChIKey of the compound is PGFBXGVRMFTYGX-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES of the compound is CCCOC1=C(C=CC(=C1)C(=O)O)OC.

What is the CAS number of the compound?

The CAS number of the compound is 5922-57-6.

What is the EC number of the compound?

The EC number of the compound is 629-956-2.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 2.5.

Is the compound a canonicalized compound?

Yes, the compound is canonicalized.