CAS
1001907-57-8 Purity
---
1001907-57-8 Purity
---
Inquiry Basket
3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid
CAS
1451391-99-3
Catalog Number
ACM1451391993
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
The molecular formula is C8H7BF4O3.
What is the PubChem CID of 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
The PubChem CID is 57497271.
What is the IUPAC name of 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
The IUPAC name is [3-fluoro-4-methoxy-5-(trifluoromethyl)phenyl]boronic acid.
What is the InChI of 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
The InChI is InChI=1S/C8H7BF4O3/c1-16-7-5(8(11,12)13)2-4(9(14)15)3-6(7)10/h2-3,14-15H,1H3.
What is the InChIKey of 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
The InChIKey is CZPHNKXASONXJX-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
The canonical SMILES is B(C1=CC(=C(C(=C1)F)OC)C(F)(F)F)(O)O.
What is the molecular weight of 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
The molecular weight is 237.95 g/mol.
How many hydrogen bond donor counts are there in 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
There are 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts are there in 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
There are 7 hydrogen bond acceptor counts.
How many rotatable bond counts are there in 3-Fluoro-4-methoxy-5-trifluoromethylphenylboronic acid?
There are 2 rotatable bond counts.
Recommended Products
