850568-74-0 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3-Ethoxy-5-fluorobenzeneboronic acid is C8H10BFO3.
The molecular weight of 3-Ethoxy-5-fluorobenzeneboronic acid is 183.97 g/mol.
The IUPAC name of 3-Ethoxy-5-fluorobenzeneboronic acid is (3-ethoxy-5-fluorophenyl)boronic acid.
The InChI of 3-Ethoxy-5-fluorobenzeneboronic acid is InChI=1S/C8H10BFO3/c1-2-13-8-4-6(9(11)12)3-7(10)5-8/h3-5,11-12H,2H2,1H3.
The InChIKey of 3-Ethoxy-5-fluorobenzeneboronic acid is OVVBLFYHZAMJIK-UHFFFAOYSA-N.
The canonical SMILES of 3-Ethoxy-5-fluorobenzeneboronic acid is B(C1=CC(=CC(=C1)F)OCC)(O)O.
The CAS number of 3-Ethoxy-5-fluorobenzeneboronic acid is 850589-53-6.
The European Community (EC) number of 3-Ethoxy-5-fluorobenzeneboronic acid is 834-843-8.
The hydrogen bond donor count of 3-Ethoxy-5-fluorobenzeneboronic acid is 2.
The hydrogen bond acceptor count of 3-Ethoxy-5-fluorobenzeneboronic acid is 4.