850568-54-6 Purity
98%
If you have any other questions or need other size, please get a quote.
Specification
The molecular formula of 3-(Propoxycarbonyl)phenylboronic acid is C10H13BO4.
The molecular weight of 3-(Propoxycarbonyl)phenylboronic acid is 208.02 g/mol.
The IUPAC name of 3-(Propoxycarbonyl)phenylboronic acid is (3-propoxycarbonylphenyl)boronic acid.
The InChI key of 3-(Propoxycarbonyl)phenylboronic acid is BSCFVVVAJINDLA-UHFFFAOYSA-N.
The canonical SMILES representation of 3-(Propoxycarbonyl)phenylboronic acid is B(C1=CC(=CC=C1)C(=O)OCCC)(O)O.
The CAS number of 3-(Propoxycarbonyl)phenylboronic acid is 850568-78-4.
The hydrogen bond donor count of 3-(Propoxycarbonyl)phenylboronic acid is 2.
The hydrogen bond acceptor count of 3-(Propoxycarbonyl)phenylboronic acid is 4.
The rotatable bond count of 3-(Propoxycarbonyl)phenylboronic acid is 5.
Yes, 3-(Propoxycarbonyl)phenylboronic acid is a canonicalized compound.