3-(Dimethylamino)phenethyl alcohol

• Catalog Number: ACMA00000822
• Category: Amines
• Molecular Weight: 165.23
• Molecular Formula: C₁₀H₁₅N
• Hazard Statements: H301-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS06

Custom Q&A

What is the molecular formula of 3-(Dimethylamino)phenethyl alcohol?

The molecular formula is C10H15NO.

What is the molecular weight of 3-(Dimethylamino)phenethyl alcohol?

The molecular weight is 165.23 g/mol.

What is the IUPAC name of 3-(Dimethylamino)phenethyl alcohol?

The IUPAC name is 2-[3-(dimethylamino)phenyl]ethanol.

What is the InChI of 3-(Dimethylamino)phenethyl alcohol?

The InChI is InChI=1S/C10H15NO/c1-11(2)10-5-3-4-9(8-10)6-7-12/h3-5,8,12H,6-7H2,1-2H3.

What is the InChIKey of 3-(Dimethylamino)phenethyl alcohol?

The InChIKey is VIISSTVGKYVFKS-UHFFFAOYSA-N.

What is the canonical SMILES of 3-(Dimethylamino)phenethyl alcohol?

The canonical SMILES is CN(C)C1=CC=CC(=C1)CCO.

What is the XLogP3 value of 3-(Dimethylamino)phenethyl alcohol?

The XLogP3 value is 2.

How many hydrogen bond donor counts does 3-(Dimethylamino)phenethyl alcohol have?

It has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 3-(Dimethylamino)phenethyl alcohol have?

It has 2 hydrogen bond acceptor counts.

How many rotatable bond counts does 3-(Dimethylamino)phenethyl alcohol have?

It has 3 rotatable bond counts.