3-Cyano-2-fluorophenylboronic acid

• CAS: 957121-05-0
• Catalog Number: ACM957121050
• Category: Boronic Acids
• Molecular Formula: C₇H₅NO₂BF

Custom Q&A

What is the molecular formula of 3-Cyano-2-fluorophenylboronic acid?

The molecular formula of 3-Cyano-2-fluorophenylboronic acid is C7H5BFNO2.

What is the molecular weight of 3-Cyano-2-fluorophenylboronic acid?

The molecular weight of 3-Cyano-2-fluorophenylboronic acid is 164.93 g/mol.

What is the IUPAC name of 3-Cyano-2-fluorophenylboronic acid?

The IUPAC name of 3-Cyano-2-fluorophenylboronic acid is (3-cyano-2-fluorophenyl)boronic acid.

What is the InChI of 3-Cyano-2-fluorophenylboronic acid?

The InChI of 3-Cyano-2-fluorophenylboronic acid is InChI=1S/C7H5BFNO2/c9-7-5(4-10)2-1-3-6(7)8(11)12/h1-3,11-12H.

What is the InChIKey of 3-Cyano-2-fluorophenylboronic acid?

The InChIKey of 3-Cyano-2-fluorophenylboronic acid is HENIWPFEWBREIB-UHFFFAOYSA-N.

What is the canonical SMILES of 3-Cyano-2-fluorophenylboronic acid?

The canonical SMILES of 3-Cyano-2-fluorophenylboronic acid is B(C1=C(C(=CC=C1)C#N)F)(O)O.

What is the CAS number of 3-Cyano-2-fluorophenylboronic acid?

The CAS number of 3-Cyano-2-fluorophenylboronic acid is 957121-05-0.

What is the European Community (EC) number of 3-Cyano-2-fluorophenylboronic acid?

The European Community (EC) number of 3-Cyano-2-fluorophenylboronic acid is 689-314-2.

Is 3-Cyano-2-fluorophenylboronic acid a canonicalized compound?

Yes, 3-Cyano-2-fluorophenylboronic acid is a canonicalized compound according to PubChem.