CAS
957062-67-8 Purity
98%
957062-67-8 Purity
98%
Inquiry Basket
5-Fluoro-2-methoxy-3-pyridineboronic acid
CAS
957120-32-0
Catalog Number
ACM957120320
Category
Boronic Acids
Molecular Formula
C6H7BFNO3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The molecular formula of 5-Fluoro-2-methoxy-3-pyridineboronic acid is C6H7BFNO3.
What is the molecular weight of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The molecular weight of 5-Fluoro-2-methoxy-3-pyridineboronic acid is 170.94 g/mol.
What is the IUPAC name of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The IUPAC name of 5-Fluoro-2-methoxy-3-pyridineboronic acid is (5-fluoro-2-methoxypyridin-3-yl)boronic acid.
What is the InChI of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The InChI of 5-Fluoro-2-methoxy-3-pyridineboronic acid is InChI=1S/C6H7BFNO3/c1-12-6-5(7(10)11)2-4(8)3-9-6/h2-3,10-11H,1H3.
What is the InChIKey of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The InChIKey of 5-Fluoro-2-methoxy-3-pyridineboronic acid is ASPZNHZSIQDSTM-UHFFFAOYSA-N.
What is the canonical SMILES of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The canonical SMILES of 5-Fluoro-2-methoxy-3-pyridineboronic acid is B(C1=CC(=CN=C1OC)F)(O)O.
What is the CAS number of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The CAS number of 5-Fluoro-2-methoxy-3-pyridineboronic acid is 957120-32-0.
What is the EC number of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The EC number of 5-Fluoro-2-methoxy-3-pyridineboronic acid is 687-930-6.
What is the hydrogen bond donor count of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The hydrogen bond donor count of 5-Fluoro-2-methoxy-3-pyridineboronic acid is 2.
What is the hydrogen bond acceptor count of 5-Fluoro-2-methoxy-3-pyridineboronic acid?
The hydrogen bond acceptor count of 5-Fluoro-2-methoxy-3-pyridineboronic acid is 5.
Recommended Products
