CAS
--- Purity
---
--- Purity
---
Inquiry Basket
3-Chloro-2,6-difluorobenzyl bromide
Catalog Number
ACMA00000681
Category
Alkyl
Molecular Weight
241.46
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H302-H315-H318-H335
RIDADR
NONH for all modes of transport
Symbol
GHS05
What is the molecular formula of 3-Chloro-2,6-difluorobenzyl bromide?
The molecular formula of 3-Chloro-2,6-difluorobenzyl bromide is C7H4BrClF2.
What is the molecular weight of 3-Chloro-2,6-difluorobenzyl bromide?
The molecular weight of 3-Chloro-2,6-difluorobenzyl bromide is 241.46 g/mol.
What is the IUPAC name of 3-Chloro-2,6-difluorobenzyl bromide?
The IUPAC name of 3-Chloro-2,6-difluorobenzyl bromide is 3-(bromomethyl)-1-chloro-2,4-difluorobenzene.
What is the InChI of 3-Chloro-2,6-difluorobenzyl bromide?
The InChI of 3-Chloro-2,6-difluorobenzyl bromide is InChI=1S/C7H4BrClF2/c8-3-4-6(10)2-1-5(9)7(4)11/h1-2H,3H2.
What is the InChIKey of 3-Chloro-2,6-difluorobenzyl bromide?
The InChIKey of 3-Chloro-2,6-difluorobenzyl bromide is SNOJSRMVFAKBEG-UHFFFAOYSA-N.
How many hydrogen bond donor counts does 3-Chloro-2,6-difluorobenzyl bromide have?
3-Chloro-2,6-difluorobenzyl bromide has 0 hydrogen bond donor counts.
What is the exact mass of 3-Chloro-2,6-difluorobenzyl bromide?
The exact mass of 3-Chloro-2,6-difluorobenzyl bromide is 239.91530 g/mol.
Does 3-Chloro-2,6-difluorobenzyl bromide have any topological polar surface area?
No, 3-Chloro-2,6-difluorobenzyl bromide has a topological polar surface area of 0Ų.
How many heavy atoms are present in the molecule of 3-Chloro-2,6-difluorobenzyl bromide?
There are 11 heavy atoms present in the molecule of 3-Chloro-2,6-difluorobenzyl bromide.
Is 3-Chloro-2,6-difluorobenzyl bromide considered as a canonicalized compound?
Yes, 3-Chloro-2,6-difluorobenzyl bromide is considered as a canonicalized compound.
Recommended Products
