CAS
--- Purity
---
--- Purity
---
Inquiry Basket
2,4-Dichloro-5-fluorobenzyl bromide
Catalog Number
ACMA00000682
Category
Alkyl
Molecular Weight
257.92
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H315-H319-H335
RIDADR
UN 1993C 3 / PGIII
Symbol
GHS07
What is the molecular formula of 2,4-Dichloro-5-fluorobenzyl bromide?
The molecular formula of 2,4-Dichloro-5-fluorobenzyl bromide is C7H4BrCl2F.
What is the molecular weight of 2,4-Dichloro-5-fluorobenzyl bromide?
The molecular weight of 2,4-Dichloro-5-fluorobenzyl bromide is 257.91 g/mol.
What is the IUPAC name of 2,4-Dichloro-5-fluorobenzyl bromide?
The IUPAC name of 2,4-Dichloro-5-fluorobenzyl bromide is 1-(bromomethyl)-2,4-dichloro-5-fluorobenzene.
What is the InChI of 2,4-Dichloro-5-fluorobenzyl bromide?
The InChI of 2,4-Dichloro-5-fluorobenzyl bromide is InChI=1S/C7H4BrCl2F/c8-3-4-1-7(11)6(10)2-5(4)9/h1-2H,3H2.
What is the InChIKey of 2,4-Dichloro-5-fluorobenzyl bromide?
The InChIKey of 2,4-Dichloro-5-fluorobenzyl bromide is SXAZGVVUQUTRIS-UHFFFAOYSA-N.
What is the canonical SMILES of 2,4-Dichloro-5-fluorobenzyl bromide?
The canonical SMILES of 2,4-Dichloro-5-fluorobenzyl bromide is C1=C(C(=CC(=C1F)Cl)Cl)CBr.
What is the CAS number of 2,4-Dichloro-5-fluorobenzyl bromide?
The CAS number of 2,4-Dichloro-5-fluorobenzyl bromide is 261763-27-3.
What is the European Community (EC) number of 2,4-Dichloro-5-fluorobenzyl bromide?
The European Community (EC) number of 2,4-Dichloro-5-fluorobenzyl bromide is 670-754-9.
What is the DSSTox Substance ID of 2,4-Dichloro-5-fluorobenzyl bromide?
The DSSTox Substance ID of 2,4-Dichloro-5-fluorobenzyl bromide is DTXSID10378843.
Is 2,4-Dichloro-5-fluorobenzyl bromide a canonicalized compound?
Yes, 2,4-Dichloro-5-fluorobenzyl bromide is a canonicalized compound.
Recommended Products
