What is the molecular formula of the compound 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid?
The molecular formula is C13H11BClFO3.
What is the molecular weight of 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid?
The molecular weight is 280.49 g/mol.
When was the compound 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid created?
The compound was created on January 26, 2010.
When was the compound 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid last modified?
The compound was last modified on December 2, 2023.
What is the IUPAC name of 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid?
The IUPAC name is (2-chloro-6-fluoro-3-phenylmethoxyphenyl)boronic acid.
What is the InChI of 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid?
The InChI is InChI=1S/C13H11BClFO3/c15-13-11(7-6-10(16)12(13)14(17)18)19-8-9-4-2-1-3-5-9/h1-7,17-18H,8H2.
What is the InChIKey of 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid?
The InChIKey is LXIZYHYNGUDZKO-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid?
The canonical SMILES is B(C1=C(C=CC(=C1Cl)OCC2=CC=CC=C2)F)(O)O.
What is the CAS number of 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid?
The CAS number is 957062-67-8.
What is the molecular weight of 3-Benzyloxy-2-chloro-6-fluorophenylboronic acid computed by PubChem?
The molecular weight computed by PubChem is 280.49 g/mol.