--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 3-amino-3-[4-(trifluoromethyl)phenyl]propan-1-ol.
The molecular formula of the compound is C10H12F3NO.
The molecular weight of the compound is 219.20 g/mol.
The InChI of the compound is InChI=1S/C10H12F3NO/c11-10(12,13)8-3-1-7(2-4-8)9(14)5-6-15/h1-4,9,15H,5-6,14H2.
The InChIKey of the compound is MPKKRINVDNIFBP-UHFFFAOYSA-N.
The canonical SMILES of the compound is C1=CC(=CC=C1C(CCO)N)C(F)(F)F.
The CAS number of the compound is 787615-24-1.
The XLogP3-AA value of the compound is 1.4.
The compound has 2 hydrogen bond donor counts.
The compound has 3 rotatable bond counts.