3,5-Dihydroxy-4-methylbenzoic acid

• Catalog Number: ACMA00000444
• Category: Alcohols
• Molecular Weight: 168.15
• Molecular Formula: C₈H₈Cl₂O
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3,5-Dihydroxy-4-methylbenzoic acid?

The molecular formula of 3,5-Dihydroxy-4-methylbenzoic acid is C8H8O4.

What is the molecular weight of 3,5-Dihydroxy-4-methylbenzoic acid?

The molecular weight of 3,5-Dihydroxy-4-methylbenzoic acid is 168.15 g/mol.

What is the IUPAC name of 3,5-Dihydroxy-4-methylbenzoic acid?

The IUPAC name of 3,5-Dihydroxy-4-methylbenzoic acid is 3,5-dihydroxy-4-methylbenzoic acid.

What is the InChI of 3,5-Dihydroxy-4-methylbenzoic acid?

The InChI of 3,5-Dihydroxy-4-methylbenzoic acid is InChI=1S/C8H8O4/c1-4-6(9)2-5(8(11)12)3-7(4)10/h2-3,9-10H,1H3,(H,11,12).

What is the InChIKey of 3,5-Dihydroxy-4-methylbenzoic acid?

The InChIKey of 3,5-Dihydroxy-4-methylbenzoic acid is KMRRXSZDSGYLCD-UHFFFAOYSA-N.

What is the Canonical SMILES of 3,5-Dihydroxy-4-methylbenzoic acid?

The Canonical SMILES of 3,5-Dihydroxy-4-methylbenzoic acid is CC1=C(C=C(C=C1O)C(=O)O).

What is the CAS number of 3,5-Dihydroxy-4-methylbenzoic acid?

The CAS number of 3,5-Dihydroxy-4-methylbenzoic acid is 28026-96-2.

How many hydrogen bond donor atoms are present in 3,5-Dihydroxy-4-methylbenzoic acid?

There are 3 hydrogen bond donor atoms present in 3,5-Dihydroxy-4-methylbenzoic acid.

How many hydrogen bond acceptor atoms are present in 3,5-Dihydroxy-4-methylbenzoic acid?

There are 4 hydrogen bond acceptor atoms present in 3,5-Dihydroxy-4-methylbenzoic acid.