3,4-Dichlorophenylthioethanol

• Catalog Number: ACMA00000445
• Category: Alcohols
• Molecular Weight: 223.12
• Molecular Formula: C₈H₈Cl₂OS
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3,4-Dichlorophenylthioethanol?

The molecular formula of 3,4-Dichlorophenylthioethanol is C8H8Cl2OS.

What is the molecular weight of 3,4-Dichlorophenylthioethanol?

The molecular weight of 3,4-Dichlorophenylthioethanol is 223.12 g/mol.

When was 3,4-Dichlorophenylthioethanol created?

3,4-Dichlorophenylthioethanol was created on July 19, 2005.

What is the IUPAC name of 3,4-Dichlorophenylthioethanol?

The IUPAC name of 3,4-Dichlorophenylthioethanol is 2-(3,4-dichlorophenyl)sulfanylethanol.

What is the InChI of 3,4-Dichlorophenylthioethanol?

The InChI of 3,4-Dichlorophenylthioethanol is InChI=1S/C8H8Cl2OS/c9-7-2-1-6(5-8(7)10)12-4-3-11/h1-2,5,11H,3-4H2.

What is the InChIKey of 3,4-Dichlorophenylthioethanol?

The InChIKey of 3,4-Dichlorophenylthioethanol is BWRURDYHPUVXMI-UHFFFAOYSA-N.

What is the canonical SMILES of 3,4-Dichlorophenylthioethanol?

The canonical SMILES of 3,4-Dichlorophenylthioethanol is C1=CC(=C(C=C1SCCO)Cl)Cl.

What is the XLogP3 value of 3,4-Dichlorophenylthioethanol?

The XLogP3 value of 3,4-Dichlorophenylthioethanol is 3.2.

How many hydrogen bond donor counts does 3,4-Dichlorophenylthioethanol have?

3,4-Dichlorophenylthioethanol has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does 3,4-Dichlorophenylthioethanol have?

3,4-Dichlorophenylthioethanol has 2 hydrogen bond acceptor counts.