CAS
917969-79-0 Purity
98%
917969-79-0 Purity
98%
Inquiry Basket
3,5-Difluoro-4-carboxyphenylboronic acid
CAS
1029716-94-6
Catalog Number
ACM1029716946
Category
Boronic Acids
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3,5-Difluoro-4-carboxyphenylboronic acid?
The molecular formula of 3,5-Difluoro-4-carboxyphenylboronic acid is C7H5BF2O4.
What are the synonyms for 3,5-Difluoro-4-carboxyphenylboronic acid?
The synonyms for 3,5-Difluoro-4-carboxyphenylboronic acid are 1029716-94-6, 4-Borono-2,6-difluorobenzoic acid, 3,5-Difluoro-4-carboxyphenylboronic acid, MFCD13181636, and 4-Borono-2,6-difluorobenzoicacid.
What is the molecular weight of 3,5-Difluoro-4-carboxyphenylboronic acid?
The molecular weight of 3,5-Difluoro-4-carboxyphenylboronic acid is 201.92 g/mol.
What is the IUPAC name of 3,5-Difluoro-4-carboxyphenylboronic acid?
The IUPAC name of 3,5-Difluoro-4-carboxyphenylboronic acid is 4-borono-2,6-difluorobenzoic acid.
What is the InChI of 3,5-Difluoro-4-carboxyphenylboronic acid?
The InChI of 3,5-Difluoro-4-carboxyphenylboronic acid is InChI=1S/C7H5BF2O4/c9-4-1-3(8(13)14)2-5(10)6(4)7(11)12/h1-2,13-14H,(H,11,12).
What is the InChIKey of 3,5-Difluoro-4-carboxyphenylboronic acid?
The InChIKey of 3,5-Difluoro-4-carboxyphenylboronic acid is AWIXNRNZROUJQB-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,5-Difluoro-4-carboxyphenylboronic acid?
The Canonical SMILES of 3,5-Difluoro-4-carboxyphenylboronic acid is B(C1=CC(=C(C(=C1)F)C(=O)O)F)(O)O.
What is the CAS number of 3,5-Difluoro-4-carboxyphenylboronic acid?
The CAS number of 3,5-Difluoro-4-carboxyphenylboronic acid is 1029716-94-6.
Is 3,5-Difluoro-4-carboxyphenylboronic acid a canonicalized compound?
Yes, 3,5-Difluoro-4-carboxyphenylboronic acid is a canonicalized compound.
Recommended Products
