4-Ethoxycarbonylmethylphenylboronic acid

• CAS: 92243-74-8
• Catalog Number: ACM92243748
• Category: Other Products; Boronic Acids
• Molecular Weight: 208.01882
• Molecular Formula: C₁₀H₁₃BO₄

Custom Reviews

May 23, 2023

---

A useful catalyst.
In the experiment, 4-Ethoxycarbonylmethylphenylboronic acid can efficiently prepare oxyhydroxylated phenolic compounds.

Custom Q&A

What is the molecular formula of 4-Ethoxycarbonylmethylphenylboronic acid?

The molecular formula is C10H13BO4.

What is the molecular weight of 4-Ethoxycarbonylmethylphenylboronic acid?

The molecular weight is 208.02 g/mol.

What is the IUPAC name of 4-Ethoxycarbonylmethylphenylboronic acid?

The IUPAC name is [4-(2-ethoxy-2-oxoethyl)phenyl]boronic acid.

What is the InChI of 4-Ethoxycarbonylmethylphenylboronic acid?

The InChI is InChI=1S/C10H13BO4/c1-2-15-10(12)7-8-3-5-9(6-4-8)11(13)14/h3-6,13-14H,2,7H2,1H3.

What is the InChIKey of 4-Ethoxycarbonylmethylphenylboronic acid?

The InChIKey is RDIRUZGSOKLANG-UHFFFAOYSA-N.

What is the CAS number of 4-Ethoxycarbonylmethylphenylboronic acid?

The CAS number is 92243-74-8.

What is the EC number of 4-Ethoxycarbonylmethylphenylboronic acid?

The EC number is 800-450-5.

What is the hydrogen bond donor count of 4-Ethoxycarbonylmethylphenylboronic acid?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of 4-Ethoxycarbonylmethylphenylboronic acid?

The hydrogen bond acceptor count is 4.

Is 4-Ethoxycarbonylmethylphenylboronic acid a canonicalized compound?

Yes, it is a canonicalized compound.