3,5-Dibromoisonicotinaldehyde

CAS

70201-42-2

Catalog Number

ACM70201422

Category

Bromine Series

Molecular Weight

264.9

Molecular Formula

C₆H₃Br₂NO

MSDS COA Spec Sheet

If you have any other questions or need other size, please get a quote.

What is the molecular formula of 3,5-dibromoisonicotinaldehyde?

The molecular formula of 3,5-dibromoisonicotinaldehyde is C6H3Br2NO.

What are the synonyms for 3,5-dibromoisonicotinaldehyde?

The synonyms for 3,5-dibromoisonicotinaldehyde are 70201-42-2, 3,5-dibromopyridine-4-carbaldehyde, 3,5-dibromopyridine-4-carboxaldehyde, and 3,5-Dibromo-4-pyridinecarboxaldehyde.

What is the molecular weight of 3,5-dibromoisonicotinaldehyde?

The molecular weight of 3,5-dibromoisonicotinaldehyde is 264.90 g/mol.

When was 3,5-dibromoisonicotinaldehyde created and last modified?

3,5-dibromoisonicotinaldehyde was created on July 19, 2005, and last modified on December 2, 2023.

What is the IUPAC name of 3,5-dibromoisonicotinaldehyde?

The IUPAC name of 3,5-dibromoisonicotinaldehyde is 3,5-dibromopyridine-4-carbaldehyde.

What is the InChI of 3,5-dibromoisonicotinaldehyde?

The InChI of 3,5-dibromoisonicotinaldehyde is InChI=1S/C6H3Br2NO/c7-5-1-9-2-6(8)4(5)3-10/h1-3H.

What is the InChIKey of 3,5-dibromoisonicotinaldehyde?

The InChIKey of 3,5-dibromoisonicotinaldehyde is WPBYVMDYYFWYAY-UHFFFAOYSA-N.

What is the canonical SMILES of 3,5-dibromoisonicotinaldehyde?

The canonical SMILES of 3,5-dibromoisonicotinaldehyde is C1=C(C(=C(C=N1)Br)C=O)Br.

What is the CAS number of 3,5-dibromoisonicotinaldehyde?

The CAS number of 3,5-dibromoisonicotinaldehyde is 70201-42-2.

What is the molecular weight, XLogP3-AA, hydrogen bond donor count, hydrogen bond acceptor count, and rotatable bond count of 3,5-dibromoisonicotinaldehyde?

The molecular weight of 3,5-dibromoisonicotinaldehyde is 264.90 g/mol.
The XLogP3-AA value of 3,5-dibromoisonicotinaldehyde is 1.7.
The hydrogen bond donor count of 3,5-dibromoisonicotinaldehyde is 0.
The hydrogen bond acceptor count of 3,5-dibromoisonicotinaldehyde is 2.
The rotatable bond count of 3,5-dibromoisonicotinaldehyde is 1.