CAS
701-07-5 Purity
96%
701-07-5 Purity
96%
Inquiry Basket
3-Bromo-5-(tosylmethyl)pyridine
CAS
866021-35-4
Catalog Number
ACM866021354
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 3-Bromo-5-(tosylmethyl)pyridine?
The molecular formula of 3-Bromo-5-(tosylmethyl)pyridine is C13H12BrNO2S.
What is the molecular weight of 3-Bromo-5-(tosylmethyl)pyridine?
The molecular weight of 3-Bromo-5-(tosylmethyl)pyridine is 326.21 g/mol.
What is the IUPAC name of 3-Bromo-5-(tosylmethyl)pyridine?
The IUPAC name of 3-Bromo-5-(tosylmethyl)pyridine is 3-bromo-5-[(4-methylphenyl)sulfonylmethyl]pyridine.
What is the InChI of 3-Bromo-5-(tosylmethyl)pyridine?
The InChI of 3-Bromo-5-(tosylmethyl)pyridine is InChI=1S/C13H12BrNO2S/c1-10-2-4-13(5-3-10)18(16,17)9-11-6-12(14)8-15-7-11/h2-8H,9H2,1H3.
What is the InChIKey of 3-Bromo-5-(tosylmethyl)pyridine?
The InChIKey of 3-Bromo-5-(tosylmethyl)pyridine is UZAZPLXKWPMDNX-UHFFFAOYSA-N.
What is the canonical SMILES of 3-Bromo-5-(tosylmethyl)pyridine?
The canonical SMILES of 3-Bromo-5-(tosylmethyl)pyridine is CC1=CC=C(C=C1)S(=O)(=O)CC2=CC(=CN=C2)Br.
What is the CAS number of 3-Bromo-5-(tosylmethyl)pyridine?
The CAS number of 3-Bromo-5-(tosylmethyl)pyridine is 866021-35-4.
What is the molecular weight of 3-Bromo-5-(tosylmethyl)pyridine according to PubChem?
The molecular weight of 3-Bromo-5-(tosylmethyl)pyridine is 326.21 g/mol according to PubChem.
What is the hydrogen bond donor count of 3-Bromo-5-(tosylmethyl)pyridine?
The hydrogen bond donor count of 3-Bromo-5-(tosylmethyl)pyridine is 0.
What is the topological polar surface area of 3-Bromo-5-(tosylmethyl)pyridine?
The topological polar surface area of 3-Bromo-5-(tosylmethyl)pyridine is 55.4Ų.
Recommended Products
