(3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride

• Catalog Number: ACMA00002009
• Category: Ethers
• Molecular Weight: 199.68
• Molecular Formula: C₁₀H₁₃NO
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The molecular formula is C10H14ClNO.

What is the molecular weight of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The molecular weight is 199.68 g/mol.

What is the IUPAC name of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The IUPAC name is 3,4-dihydro-2H-chromen-6-ylmethanamine;hydrochloride.

What is the InChI of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The InChI is InChI=1S/C10H13NO.ClH/c11-7-8-3-4-10-9(6-8)2-1-5-12-10;/h3-4,6H,1-2,5,7,11H2;1H.

What is the InChIKey of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The InChIKey is PQDSUCKQNLPLQA-UHFFFAOYSA-N.

What is the Canonical SMILES of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The Canonical SMILES is C1CC2=C(C=CC(=C2)CN)OC1.Cl.

What is the CAS number of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The CAS number is 1255718-26-3.

What is the hydrogen bond donor count of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The hydrogen bond donor count is 2.

What is the hydrogen bond acceptor count of (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride?

The hydrogen bond acceptor count is 2.

Is (3,4-Dihydro-2H-chromen-6-ylmethyl)amine hydrochloride a canonicalized compound?

Yes, it is a canonicalized compound.