1-(4-Ethoxy-3-fluorophenyl)ethanamine

• Catalog Number: ACMA00002007
• Category: Ethers
• Molecular Weight: 183.22
• Molecular Formula: C₁₀H₁₃NO₃
• Hazard Statements: H302-H319
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The molecular formula is C10H14FNO.

What is the molecular weight of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The molecular weight is 183.22 g/mol.

What is the IUPAC name of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The IUPAC name is 1-(4-ethoxy-3-fluorophenyl)ethanamine.

What is the InChI of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The InChI is InChI=1S/C10H14FNO/c1-3-13-10-5-4-8(7(2)12)6-9(10)11/h4-7H,3,12H2,1-2H3.

What is the InChIKey of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The InChIKey is OFDISMSWWNOGFW-UHFFFAOYSA-N.

What is the canonical SMILES of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The canonical SMILES is CCOC1=C(C=C(C=C1)C(C)N)F.

What is the CAS number of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The CAS number is 634150-90-6.

What is the hydrogen bond donor count of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of 1-(4-ethoxy-3-fluorophenyl)ethanamine?

The hydrogen bond acceptor count is 3.

Is 1-(4-ethoxy-3-fluorophenyl)ethanamine a canonicalized compound?

Yes, it is a canonicalized compound.