3,4-Dichlorobenzotrifluoride

• CAS: 328-84-7
• Catalog Number: ACM328847
• Category: Aryl
• Molecular Weight: 215.00
• Hazard Statements: H302
• RIDADR: UN 3265 8 / PGII
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 3,4-dichlorobenzotrifluoride?

The molecular formula of 3,4-dichlorobenzotrifluoride is C7H3Cl2F3.

What is the molecular weight of 3,4-dichlorobenzotrifluoride?

The molecular weight of 3,4-dichlorobenzotrifluoride is 215.00 g/mol.

What is the IUPAC name of 3,4-dichlorobenzotrifluoride?

The IUPAC name of 3,4-dichlorobenzotrifluoride is 1,2-dichloro-4-(trifluoromethyl)benzene.

What is the Canonical SMILES of 3,4-dichlorobenzotrifluoride?

The Canonical SMILES of 3,4-dichlorobenzotrifluoride is C1=CC(=C(C=C1C(F)(F)F)Cl)Cl.

What is the CAS number of 3,4-dichlorobenzotrifluoride?

The CAS number of 3,4-dichlorobenzotrifluoride is 328-84-7.

What is the UNII of 3,4-dichlorobenzotrifluoride?

The UNII of 3,4-dichlorobenzotrifluoride is 7G60XCU4GG.

What is the XLogP3 value of 3,4-dichlorobenzotrifluoride?

The XLogP3 value of 3,4-dichlorobenzotrifluoride is 4.4.

How many hydrogen bond acceptor count does 3,4-dichlorobenzotrifluoride have?

3,4-dichlorobenzotrifluoride has 3 hydrogen bond acceptor count.

What is the topological polar surface area of 3,4-dichlorobenzotrifluoride?

The topological polar surface area of 3,4-dichlorobenzotrifluoride is 0Ų.

How many rotatable bond count does 3,4-dichlorobenzotrifluoride have?

3,4-dichlorobenzotrifluoride has 0 rotatable bond count.