2,4-Dichlorobenzotrifluoride

• CAS: 320-60-5
• Catalog Number: ACM320605
• Category: Aryl
• Molecular Weight: 215.00
• Hazard Statements: H225-H302-H331
• RIDADR: UN 1760 8 / PGII
• Symbol: GHS02

Custom Q&A

What is the molecular formula for 2,4-Dichlorobenzotrifluoride?

The molecular formula for 2,4-Dichlorobenzotrifluoride is C7H3Cl2F3.

What is the molecular weight of 2,4-Dichlorobenzotrifluoride?

The molecular weight of 2,4-Dichlorobenzotrifluoride is 215.00 g/mol.

What is the IUPAC name of 2,4-Dichlorobenzotrifluoride?

The IUPAC name of 2,4-Dichlorobenzotrifluoride is 2,4-dichloro-1-(trifluoromethyl)benzene.

What is the InChI of 2,4-Dichlorobenzotrifluoride?

The InChI of 2,4-Dichlorobenzotrifluoride is InChI=1S/C7H3Cl2F3/c8-4-1-2-5(6(9)3-4)7(10,11)12/h1-3H.

What is the InChIKey of 2,4-Dichlorobenzotrifluoride?

The InChIKey of 2,4-Dichlorobenzotrifluoride is KALSHRGEFLVFHE-UHFFFAOYSA-N.

What is the canonical SMILES of 2,4-Dichlorobenzotrifluoride?

The canonical SMILES of 2,4-Dichlorobenzotrifluoride is C1=CC(=C(C=C1Cl)Cl)C(F)(F)F.

What is the CAS number of 2,4-Dichlorobenzotrifluoride?

The CAS number of 2,4-Dichlorobenzotrifluoride is 320-60-5.

What is the European Community (EC) number of 2,4-Dichlorobenzotrifluoride?

The European Community (EC) number of 2,4-Dichlorobenzotrifluoride is 206-278-1.

What is the UNII of 2,4-Dichlorobenzotrifluoride?

The UNII of 2,4-Dichlorobenzotrifluoride is 18V6ZM0FJT.

What is the XLogP3 value of 2,4-Dichlorobenzotrifluoride?

The XLogP3 value of 2,4-Dichlorobenzotrifluoride is 4.2.