3-(1-Methylcyclopropyl)propanoic acid

• Catalog Number: ACMA00000564
• Category: Alkanes
• Molecular Weight: 128.17
• Molecular Formula: C₆H₁₁I
• Hazard Statements: H302-H318
• RIDADR: UN 2298 3 / PGII
• Symbol: GHS05

Custom Q&A

What is the molecular formula of 3-(1-Methylcyclopropyl)propanoic acid?

The molecular formula is C7H12O2.

What is the molecular weight of 3-(1-Methylcyclopropyl)propanoic acid?

The molecular weight is 128.17 g/mol.

What is the IUPAC name of the compound?

The IUPAC name is 3-(1-methylcyclopropyl)propanoic acid.

What is the InChI of the compound?

The InChI is InChI=1S/C7H12O2/c1-7(4-5-7)3-2-6(8)9/h2-5H2,1H3,(H,8,9).

What is the InChIKey of the compound?

The InChIKey is YCVOGPHTDVZENI-UHFFFAOYSA-N.

What is the canonical SMILES of the compound?

The canonical SMILES is CC1(CC1)CCC(=O)O.

What is the CAS number of the compound?

The CAS number is 87433-66-7.

What is the European Community (EC) number of the compound?

The European Community (EC) number is 843-564-0.

What is the hydrogen bond donor count of the compound?

The hydrogen bond donor count is 1.

What is the hydrogen bond acceptor count of the compound?

The hydrogen bond acceptor count is 2.