--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 1-(1-methylcyclopropyl)propan-2-one.
The molecular formula of the compound is C7H12O.
The molecular weight of the compound is 112.17 g/mol.
The CAS number of the compound is 13905-14-1.
The InChI of the compound is InChI=1S/C7H12O/c1-6(8)5-7(2)3-4-7/h3-5H2,1-2H3.
The InChIKey of the compound is NBAOSBHFUTWCHC-UHFFFAOYSA-N.
The canonical SMILES of the compound is CC(=O)CC1(CC1)C.
The XLogP3-AA value of the compound is 1.4.
The compound has 0 hydrogen bond donor counts.
The compound has 2 rotatable bond counts.