2-(Methylsulphonyl)-10H-phenothiazine

• CAS: 23503-68-6
• Catalog Number: ACM23503686
• Category: Other Products
• Molecular Weight: 277.36194
• Molecular Formula: C₁₃H₁₁NO₂S₂
• Synonyms: 2-(methylsulphonyl)-10H-phenothiazine;2-Methylsulfonyl-10H-phenothiazine;Einecs 245-701-4;10H-Phenothiazine,2-(Methylsulfonyl);2-Methylsulfonyl phenothiazine

Custom Q&A

What is the molecular formula of the compound?

The molecular formula of the compound is C13H11NO2S2.

What is the molecular weight of the compound?

The molecular weight of the compound is 277.4 g/mol.

What is the IUPAC name of the compound?

The IUPAC name of the compound is 2-methylsulfonyl-10H-phenothiazine.

What is the CAS number of the compound?

The CAS number of the compound is 23503-68-6.

What is the Canonical SMILES of the compound?

The Canonical SMILES of the compound is CS(=O)(=O)C1=CC2=C(C=C1)SC3=CC=CC=C3N2.

What is the XLogP3 value of the compound?

The XLogP3 value of the compound is 3.4.

How many hydrogen bond donor counts does the compound have?

The compound has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does the compound have?

The compound has 4 hydrogen bond acceptor counts.

What is the topological polar surface area of the compound?

The topological polar surface area of the compound is 79.8 ?2.

Is the compound canonicalized?

Yes, the compound is canonicalized.