(1R,4S,5R,6R,7S,10R)-4,10-Dimethyl-7-isopropyltricyclo[4.4.0.01,5]decane-4-ol

• CAS: 23445-02-5
• Catalog Number: ACM23445025
• Category: Other Products
• Molecular Weight: 0
• Synonyms: (1R,4S,5R,6R,7S,10R)-4,10-Dimethyl-7-isopropyltricyclo[4.4.0.01,5]decane-4-ol;(3S,3aβ,3bα,7aR)-Octahydro-3,7β-dimethyl-4α-isopropyl-1H-cyclopenta[1,3]cyclopropa[1,2]benzen-3-ol;Cubebol

Custom Q&A

What is the molecular formula of (-)-cubebol?

The molecular formula of (-)-cubebol is C15H26O.

What is the molecular weight of (-)-cubebol?

The molecular weight of (-)-cubebol is 222.37 g/mol.

What is the IUPAC name of (-)-cubebol?

The IUPAC name of (-)-cubebol is (1R,4S,5R,6R,7S,10R)-4,10-dimethyl-7-propan-2-yltricyclo[4.4.0.0 1,5]decan-4-ol.

What is the InChIKey of (-)-cubebol?

The InChIKey of (-)-cubebol is KONGRWVLXLWGDV-BYGOPZEFSA-N.

What is the canonical SMILES of (-)-cubebol?

The canonical SMILES of (-)-cubebol is CC1CCC(C2C13C2C(CC3)(C)O)C(C)C.

What is the CAS number of (-)-cubebol?

The CAS number of (-)-cubebol is 23445-02-5.

How many hydrogen bond donor counts does (-)-cubebol have?

(-)-cubebol has 1 hydrogen bond donor count.

How many hydrogen bond acceptor counts does (-)-cubebol have?

(-)-cubebol has 1 hydrogen bond acceptor count.

What is the XLogP3-AA value of (-)-cubebol?

The XLogP3-AA value of (-)-cubebol is 3.9.

What is the topological polar surface area of (-)-cubebol?

The topological polar surface area of (-)-cubebol is 20.2 Ų.