2-(Isobutylamino)ethanol hydrochloride

• Catalog Number: ACMA00001316
• Category: Amines
• Molecular Weight: 153.65
• Molecular Formula: C₆H₁₅NO₂
• Hazard Statements: H317
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-(Isobutylamino)ethanol hydrochloride?

The molecular formula is C6H16ClNO.

What is the molecular weight of 2-(Isobutylamino)ethanol hydrochloride?

The molecular weight is 153.65 g/mol.

What is the IUPAC name of 2-(Isobutylamino)ethanol hydrochloride?

The IUPAC name is 2-(2-methylpropylamino)ethanol;hydrochloride.

What is the InChI of 2-(Isobutylamino)ethanol hydrochloride?

The InChI is InChI=1S/C6H15NO.ClH/c1-6(2)5-7-3-4-8;/h6-8H,3-5H2,1-2H3;1H.

What is the InChIKey of 2-(Isobutylamino)ethanol hydrochloride?

The InChIKey is IKCSKYBVDGOHFR-UHFFFAOYSA-N.

What is the canonical SMILES of 2-(Isobutylamino)ethanol hydrochloride?

The canonical SMILES is CC(C)CNCCO.Cl.

What is the CAS number of 2-(Isobutylamino)ethanol hydrochloride?

The CAS number is 245487-94-9.

What is the European Community (EC) number of 2-(Isobutylamino)ethanol hydrochloride?

The EC number is 877-805-6.

What is the hydrogen bond donor count of 2-(Isobutylamino)ethanol hydrochloride?

The hydrogen bond donor count is 3.

What is the hydrogen bond acceptor count of 2-(Isobutylamino)ethanol hydrochloride?

The hydrogen bond acceptor count is 2.