CAS
--- Purity
---
--- Purity
---
Shopping basket
2-Fluoro-4-methoxybenzoic acid
Catalog Number
ACMA00001912
Category
Aryl Fluorinated Building Blocks
Molecular Weight
170.14
Molecular Formula
C7H4F2O3
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H301
RIDADR
NONH for all modes of transport
Symbol
GHS06
What is the molecular formula of 2-Fluoro-4-methoxybenzoic acid?
The molecular formula of 2-Fluoro-4-methoxybenzoic acid is C8H7FO3.
What is the molecular weight of 2-Fluoro-4-methoxybenzoic acid?
The molecular weight of 2-Fluoro-4-methoxybenzoic acid is 170.14 g/mol.
What is the IUPAC name of 2-Fluoro-4-methoxybenzoic acid?
The IUPAC name of 2-Fluoro-4-methoxybenzoic acid is 2-fluoro-4-methoxybenzoic acid.
What are some synonyms for 2-Fluoro-4-methoxybenzoic acid?
Some synonyms for 2-Fluoro-4-methoxybenzoic acid include 2-fluoro-4-methoxy-benzoic Acid and 2-Fluoro-p-anisic Acid.
What is the InChIKey of 2-Fluoro-4-methoxybenzoic acid?
The InChIKey of 2-Fluoro-4-methoxybenzoic acid is UPWMPIKNUXTWFP-UHFFFAOYSA-N.
What is the canonical SMILES representation of 2-Fluoro-4-methoxybenzoic acid?
The canonical SMILES representation of 2-Fluoro-4-methoxybenzoic acid is COC1=CC(=C(C=C1)C(=O)O)F.
How many hydrogen bond donor counts are there in 2-Fluoro-4-methoxybenzoic acid?
There is 1 hydrogen bond donor count in 2-Fluoro-4-methoxybenzoic acid.
What is the XLogP3 value of 2-Fluoro-4-methoxybenzoic acid?
The XLogP3 value of 2-Fluoro-4-methoxybenzoic acid is 1.9.
What is the topological polar surface area of 2-Fluoro-4-methoxybenzoic acid?
The topological polar surface area of 2-Fluoro-4-methoxybenzoic acid is 46.5 Ų.
Is the compound canonicalized in PubChem?
Yes, the compound 2-Fluoro-4-methoxybenzoic acid is canonicalized in PubChem.
Recommended Products
