2-Fluoro-4-hydroxyphenylacetic acid

• Catalog Number: ACMA00001913
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 170.14
• Hazard Statements: H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-Fluoro-4-hydroxyphenylacetic acid?

The molecular formula of 2-Fluoro-4-hydroxyphenylacetic acid is C8H7FO3.

What is the molecular weight of 2-Fluoro-4-hydroxyphenylacetic acid?

The molecular weight of 2-Fluoro-4-hydroxyphenylacetic acid is 170.14 g/mol.

What is the IUPAC name of 2-Fluoro-4-hydroxyphenylacetic acid?

The IUPAC name of 2-Fluoro-4-hydroxyphenylacetic acid is 2-(2-fluoro-4-hydroxyphenyl)acetic acid.

What is the InChI of 2-Fluoro-4-hydroxyphenylacetic acid?

The InChI of 2-Fluoro-4-hydroxyphenylacetic acid is InChI=1S/C8H7FO3/c9-7-4-6(10)2-1-5(7)3-8(11)12/h1-2,4,10H,3H2,(H,11,12).

What is the InChIKey of 2-Fluoro-4-hydroxyphenylacetic acid?

The InChIKey of 2-Fluoro-4-hydroxyphenylacetic acid is YBHJEGWOCHZSGY-UHFFFAOYSA-N.

What is the canonical SMILES representation of 2-Fluoro-4-hydroxyphenylacetic acid?

The canonical SMILES representation of 2-Fluoro-4-hydroxyphenylacetic acid is C1=CC(=C(C=C1O)F)CC(=O)O.

How many hydrogen bond donor counts does 2-Fluoro-4-hydroxyphenylacetic acid have?

2-Fluoro-4-hydroxyphenylacetic acid has 2 hydrogen bond donor counts.

What is the exact mass of 2-Fluoro-4-hydroxyphenylacetic acid?

The exact mass of 2-Fluoro-4-hydroxyphenylacetic acid is 170.03792224 g/mol.

What is the topological polar surface area of 2-Fluoro-4-hydroxyphenylacetic acid?

The topological polar surface area of 2-Fluoro-4-hydroxyphenylacetic acid is 57.5 Ų.

Is 2-Fluoro-4-hydroxyphenylacetic acid considered a canonicalized compound?

Yes, 2-Fluoro-4-hydroxyphenylacetic acid is considered a canonicalized compound according to PubChem.