2-(Cyclopentyloxy)-3-methoxybenzaldehyde

• Catalog Number: ACMA00002348
• Category: Ethers
• Molecular Weight: 220.26
• Molecular Formula: C₁₃H₁₅NO₂
• Hazard Statements: H302
• RIDADR: NONH for all modes of transport
• Symbol: GHS07

Custom Q&A

What is the molecular formula of 2-(Cyclopentyloxy)-3-methoxybenzaldehyde?

The molecular formula is C13H16O3.

What is the molecular weight of 2-(Cyclopentyloxy)-3-methoxybenzaldehyde?

The molecular weight is 220.26 g/mol.

What is the IUPAC name of 2-(Cyclopentyloxy)-3-methoxybenzaldehyde?

The IUPAC name is 2-cyclopentyloxy-3-methoxybenzaldehyde.

What is the InChI of 2-(Cyclopentyloxy)-3-methoxybenzaldehyde?

The InChI is InChI=1S/C13H16O3/c1-15-12-8-4-5-10(9-14)13(12)16-11-6-2-3-7-11/h4-5,8-9,11H,2-3,6-7H2,1H3.

What is the InChIKey of 2-(Cyclopentyloxy)-3-methoxybenzaldehyde?

The InChIKey is KVYXIZHHZDPYQE-UHFFFAOYSA-N.

What is the canonical SMILES of 2-(Cyclopentyloxy)-3-methoxybenzaldehyde?

The canonical SMILES is COC1=CC=CC(=C1OC2CCCC2)C=O.

What is the XLogP3-AA value of 2-(Cyclopentyloxy)-3-methoxybenzaldehyde?

The XLogP3-AA value is 2.6.

How many hydrogen bond donor counts does 2-(Cyclopentyloxy)-3-methoxybenzaldehyde have?

It has 0 hydrogen bond donor counts.

How many hydrogen bond acceptor counts does 2-(Cyclopentyloxy)-3-methoxybenzaldehyde have?

It has 3 hydrogen bond acceptor counts.

How many rotatable bond counts does 2-(Cyclopentyloxy)-3-methoxybenzaldehyde have?

It has 4 rotatable bond counts.