--- Purity
---
If you have any other questions or need other size, please get a quote.
Specification
The IUPAC name of the compound is 4-cyclopentyloxy-3-methoxybenzaldehyde.
The molecular formula of the compound is C13H16O3.
The molecular weight of the compound is 220.26 g/mol.
The InChIKey of the compound is UMIUDSWQJWYRLW-UHFFFAOYSA-N.
The canonical SMILES of the compound is COC1=C(C=CC(=C1)C=O)OC2CCCC2.
The CAS number of the compound is 197573-17-4.
The compound has 0 hydrogen bond donor counts.
The compound has 3 hydrogen bond acceptor counts.
The compound has 4 rotatable bond counts.
Yes, the compound is canonicalized.