CAS
103438-88-6 Purity
---
103438-88-6 Purity
---
Inquiry Basket
2-Chloro-4,5-difluorobenzoic acid
CAS
110877-64-0
Catalog Number
ACM110877640
Category
Aryl Fluorinated Building Blocks
Molecular Weight
192.55
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
Specification
Hazard Statements
H315-H319-H335
RIDADR
NONH for all modes of transport
Symbol
GHS07
What is the molecular formula of 2-Chloro-4,5-difluorobenzoic acid?
The molecular formula of 2-Chloro-4,5-difluorobenzoic acid is C7H3ClF2O2.
What is the molecular weight of 2-Chloro-4,5-difluorobenzoic acid?
The molecular weight of 2-Chloro-4,5-difluorobenzoic acid is 192.55 g/mol.
What is the IUPAC name of 2-Chloro-4,5-difluorobenzoic acid?
The IUPAC name of 2-Chloro-4,5-difluorobenzoic acid is 2-chloro-4,5-difluorobenzoic acid.
What is the InChI of 2-Chloro-4,5-difluorobenzoic acid?
The InChI of 2-Chloro-4,5-difluorobenzoic acid is InChI=1S/C7H3ClF2O2/c8-4-2-6(10)5(9)1-3(4)7(11)12/h1-2H,(H,11,12).
What is the InChIKey of 2-Chloro-4,5-difluorobenzoic acid?
The InChIKey of 2-Chloro-4,5-difluorobenzoic acid is CGFMLBSNHNWJAW-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Chloro-4,5-difluorobenzoic acid?
The Canonical SMILES of 2-Chloro-4,5-difluorobenzoic acid is C1=C(C(=CC(=C1F)F)Cl)C(=O)O.
What is the CAS number of 2-Chloro-4,5-difluorobenzoic acid?
The CAS number of 2-Chloro-4,5-difluorobenzoic acid is 110877-64-0.
What is the XLogP3 value of 2-Chloro-4,5-difluorobenzoic acid?
The XLogP3 value of 2-Chloro-4,5-difluorobenzoic acid is 2.4.
What is the hydrogen bond donor count of 2-Chloro-4,5-difluorobenzoic acid?
The hydrogen bond donor count of 2-Chloro-4,5-difluorobenzoic acid is 1.
What is the hydrogen bond acceptor count of 2-Chloro-4,5-difluorobenzoic acid?
The hydrogen bond acceptor count of 2-Chloro-4,5-difluorobenzoic acid is 4.
Recommended Products
