2,4,5-Trifluoro-3-methoxybenzoic acid

• CAS: 112811-65-1
• Catalog Number: ACM112811651
• Category: Aryl Fluorinated Building Blocks
• Molecular Weight: 206.12
• Hazard Statements: H226-H302 + H312 + H332-H315-H319-H335
• RIDADR: NONH for all modes of transport
• Symbol: GHS02

Custom Q&A

What is the molecular formula of 2,4,5-Trifluoro-3-methoxybenzoic acid?

Molecular Formula: C8H5F3O3

What are some synonyms for 2,4,5-Trifluoro-3-methoxybenzoic acid?

Synonyms include 3-methoxy-2,4,5-trifluorobenzoic acid, and others

When was 2,4,5-Trifluoro-3-methoxybenzoic acid first created and modified?

Created: 2005-07-19
Modified: 2023-12-23

What is the molecular weight of 2,4,5-Trifluoro-3-methoxybenzoic acid?

Molecular Weight: 206.12 g/mol

What is the IUPAC Name of 2,4,5-Trifluoro-3-methoxybenzoic acid?

IUPAC Name: 2,4,5-trifluoro-3-methoxybenzoic acid

What is the InChI of 2,4,5-Trifluoro-3-methoxybenzoic acid?

InChI=1S/C8H5F3O3/c1-14-7-5(10)3(8(12)13)2-4(9)6(7)11/h2H,1H3,(H,12,13)

What is the InChIKey of 2,4,5-Trifluoro-3-methoxybenzoic acid?

InChIKey: YVJHZWWMKFQKDC-UHFFFAOYSA-N

What is the Canonical SMILES of 2,4,5-Trifluoro-3-methoxybenzoic acid?

Canonical SMILES: COC1=C(C(=CC(=C1F)F)C(=O)O)F

What is the XLogP3-AA value of 2,4,5-Trifluoro-3-methoxybenzoic acid?

XLogP3-AA: 1.7

How many hydrogen bond acceptors does 2,4,5-Trifluoro-3-methoxybenzoic acid have?

Hydrogen Bond Acceptor Count: 6