CAS
38692-80-7 Purity
---
38692-80-7 Purity
---
Inquiry Basket
2-Bromo-5-fluorobenzoic acid
CAS
394-28-5
Catalog Number
ACM394285
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-5-fluorobenzoic acid?
The molecular formula of 2-Bromo-5-fluorobenzoic acid is C7H4BrFO2.
What is the molecular weight of 2-Bromo-5-fluorobenzoic acid?
The molecular weight of 2-Bromo-5-fluorobenzoic acid is 219.01 g/mol.
What is the IUPAC name of 2-Bromo-5-fluorobenzoic acid?
The IUPAC name of 2-Bromo-5-fluorobenzoic acid is 2-bromo-5-fluorobenzoic acid.
What is the InChI key of 2-Bromo-5-fluorobenzoic acid?
The InChI key of 2-Bromo-5-fluorobenzoic acid is OQBMJMJZMDBQSM-UHFFFAOYSA-N.
What is the canonical SMILES of 2-Bromo-5-fluorobenzoic acid?
The canonical SMILES of 2-Bromo-5-fluorobenzoic acid is C1=CC(=C(C=C1F)C(=O)O)Br.
What is the CAS number of 2-Bromo-5-fluorobenzoic acid?
The CAS number of 2-Bromo-5-fluorobenzoic acid is 394-28-5.
What is the Nikkaji Number of 2-Bromo-5-fluorobenzoic acid?
The Nikkaji Number of 2-Bromo-5-fluorobenzoic acid is J2.555.091I.
What is the XLogP3 value of 2-Bromo-5-fluorobenzoic acid?
The XLogP3 value of 2-Bromo-5-fluorobenzoic acid is 3.1.
What is the hydrogen bond donor count of 2-Bromo-5-fluorobenzoic acid?
The hydrogen bond donor count of 2-Bromo-5-fluorobenzoic acid is 1.
What is the hydrogen bond acceptor count of 2-Bromo-5-fluorobenzoic acid?
The hydrogen bond acceptor count of 2-Bromo-5-fluorobenzoic acid is 3.
Recommended Products
