CAS
38603-09-7 Purity
---
38603-09-7 Purity
---
Inquiry Basket
2,3-Diamino-5-bromopyridine
CAS
38875-53-5
Catalog Number
ACM38875535
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2,3-Diamino-5-bromopyridine?
The molecular formula of 2,3-Diamino-5-bromopyridine is C5H6BrN3.
What is the molecular weight of 2,3-Diamino-5-bromopyridine?
The molecular weight of 2,3-Diamino-5-bromopyridine is 188.03 g/mol.
What is the IUPAC name of 2,3-Diamino-5-bromopyridine?
The IUPAC name of 2,3-Diamino-5-bromopyridine is 5-bromopyridine-2,3-diamine.
What is the InChI of 2,3-Diamino-5-bromopyridine?
The InChI of 2,3-Diamino-5-bromopyridine is InChI=1S/C5H6BrN3/c6-3-1-4(7)5(8)9-2-3/h1-2H,7H2,(H2,8,9).
What is the InChIKey of 2,3-Diamino-5-bromopyridine?
The InChIKey of 2,3-Diamino-5-bromopyridine is YRGMYJUKFJPNPD-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Diamino-5-bromopyridine?
The canonical SMILES of 2,3-Diamino-5-bromopyridine is C1=C(C=NC(=C1N)N)Br.
What is the CAS number of 2,3-Diamino-5-bromopyridine?
The CAS number of 2,3-Diamino-5-bromopyridine is 38875-53-5.
What is the European Community (EC) number of 2,3-Diamino-5-bromopyridine?
The European Community (EC) number of 2,3-Diamino-5-bromopyridine is 254-172-9.
What is the ChEMBL ID of 2,3-Diamino-5-bromopyridine?
The ChEMBL ID of 2,3-Diamino-5-bromopyridine is CHEMBL4060760.
Is 2,3-Diamino-5-bromopyridine a canonicalized compound?
Yes, 2,3-Diamino-5-bromopyridine is a canonicalized compound according to PubChem.
Recommended Products
