CAS
59557-92-5 Purity
98%
59557-92-5 Purity
98%
Inquiry Basket
2-Bromo-2-methyl-1-phenylpropan-1-one
CAS
10409-54-8
Catalog Number
ACM10409548
Category
Bromine Series
If you have any other questions or need other size, please get a quote.
- Product Description
- Case Study
- Custom Reviews
- Custom Q&A
- Synthetic Use
- Related Resources
What is the molecular formula of 2-Bromo-2-methyl-1-phenylpropan-1-one?
The molecular formula of 2-Bromo-2-methyl-1-phenylpropan-1-one is C10H11BrO.
What is the molecular weight of 2-Bromo-2-methyl-1-phenylpropan-1-one?
The molecular weight of 2-Bromo-2-methyl-1-phenylpropan-1-one is 227.10 g/mol.
What are some synonyms for 2-Bromo-2-methyl-1-phenylpropan-1-one?
Some synonyms for 2-Bromo-2-methyl-1-phenylpropan-1-one include 2-Bromo-2-methylpropiophenone and 2-Bromoisobutyrophenone.
What is the InChIKey for 2-Bromo-2-methyl-1-phenylpropan-1-one?
The InChIKey for 2-Bromo-2-methyl-1-phenylpropan-1-one is QMOSZSHTSOWPRX-UHFFFAOYSA-N.
What is the Canonical SMILES representation of 2-Bromo-2-methyl-1-phenylpropan-1-one?
The Canonical SMILES representation of 2-Bromo-2-methyl-1-phenylpropan-1-one is CC(C)(C(=O)C1=CC=CC=C1)Br.
What is the XLogP3-AA value for 2-Bromo-2-methyl-1-phenylpropan-1-one?
The XLogP3-AA value for 2-Bromo-2-methyl-1-phenylpropan-1-one is 3.
How many hydrogen bond donor counts does 2-Bromo-2-methyl-1-phenylpropan-1-one have?
2-Bromo-2-methyl-1-phenylpropan-1-one has 0 hydrogen bond donor counts.
What is the exact mass of 2-Bromo-2-methyl-1-phenylpropan-1-one?
The exact mass of 2-Bromo-2-methyl-1-phenylpropan-1-one is 225.99933 g/mol.
How many rotatable bond counts does 2-Bromo-2-methyl-1-phenylpropan-1-one have?
2-Bromo-2-methyl-1-phenylpropan-1-one has 2 rotatable bond counts.
Is 2-Bromo-2-methyl-1-phenylpropan-1-one a canonicalized compound?
Yes, 2-Bromo-2-methyl-1-phenylpropan-1-one is a canonicalized compound.
Recommended Products
![2-[4-(Bromomethyl)phenyl]propanoic acid](https://resource.alfa-chemistry.com/structure/111128-12-2.gif)
